CAS 73790-19-9 appears in our catalog under these names: 5-Bromo-2,2-dimethyl-1,3-benzodioxole, 98%, 5-Bromo-2,2-dimethylbenzo[d][1,3]dioxole 95%, 5-Bromo-2,2-dimethylbenzo[d][1,3]dioxole, 97%, 97%, 5-Bromo-2,2-dimethylbenzo[d][1,3]dioxole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 50mg.
5-bromo-2,2-dimethyl-1,3-benzodioxole (CAS 73790-19-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-2,2-dimethyl-1,3-benzodioxole. InChIKey: DBVCFVNYPVLZKX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-2,2-dimethyl-1,3-benzodioxole |
| InChIKey | DBVCFVNYPVLZKX-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)