Products 73816-46-3
CAS 73816-46-3 appears in our catalog under these names: 5,6-Dimethyl-2,3-dihydro-1h-indole-2,3-dione, 95%, 5,6-Dimethylisatin. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
5,6-dimethyl-1H-indole-2,3-dione (CAS 73816-46-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5,6-dimethyl-1H-indole-2,3-dione. InChIKey: BRWIXNVFRUVHEU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5,6-dimethyl-1H-indole-2,3-dione |
| InChIKey | BRWIXNVFRUVHEU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)NC(=O)C2=O |
Computed by PubChem (NCBI)
Synonyms:
5,6-dimethyl-2,3-dihydro-1H-indole-2,3-dione, 5,6-dimethylindoline-2,3-dione, 5,6-Dimethyl-1H-indole-2,3-dione, 5,6-Dimethylindole-2,3-dione, 1H-Indole-2,3-dione,5,6-dimethyl-, 1H-Indole-2,3-dione, 5,6-dimethyl-, NCIOpen2_002071, Indole-2, 5,6-dimethyl-, 1H-Indole-2, 5,6-dimethyl-, BRWIXNVFRUVHEU-UHFFFAOYSA-N