CAS 738545-14-7 appears in our catalog under these names: 2-Ethyl-4,6-dimethyl-5-pyrimidinecarboxylic acid, 95%, 2-Ethyl-4,6-dimethylpyrimidine-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-ethyl-4,6-dimethylpyrimidine-5-carboxylic acid (CAS 738545-14-7) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 2-ethyl-4,6-dimethylpyrimidine-5-carboxylic acid. InChIKey: SADLLMZNXHMVNS-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-ethyl-4,6-dimethylpyrimidine-5-carboxylic acid |
| InChIKey | SADLLMZNXHMVNS-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=C(C(=N1)C)C(=O)O)C |
Computed by PubChem (NCBI)