CAS 7390-15-0 is the registry number for Ethyl L-alanyl-L-alaninate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (CAS 7390-15-0) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate. InChIKey: LVDZTPCFSHSXMK-WDSKDSINSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| InChIKey | LVDZTPCFSHSXMK-WDSKDSINSA-N |
| SMILES | CCOC(=O)[C@H](C)NC(=O)[C@H](C)N |
Computed by PubChem (NCBI)