Products 73902-63-3
CAS 73902-63-3 is the registry number for Benzamide, N-(2-methyl-6-nitrophenyl)-, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(2-methyl-6-nitrophenyl)benzamide (CAS 73902-63-3) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: N-(2-methyl-6-nitrophenyl)benzamide. InChIKey: QPWJNEPTGDWMNC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | N-(2-methyl-6-nitrophenyl)benzamide |
| InChIKey | QPWJNEPTGDWMNC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)