CAS 73975-59-4 is the registry number for Methyl 5-hydroxy-1,2-dimethyl-1H-indole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 5-hydroxy-1,2-dimethylindole-3-carboxylate (CAS 73975-59-4) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl 5-hydroxy-1,2-dimethylindole-3-carboxylate. InChIKey: JTPMSTFUJJHJRW-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | methyl 5-hydroxy-1,2-dimethylindole-3-carboxylate |
| InChIKey | JTPMSTFUJJHJRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C)C=CC(=C2)O)C(=O)OC |
Computed by PubChem (NCBI)