CAS 741261-57-4 appears in our catalog under these names: 5-(Benzyloxy)-1H-benzo[d]imidazole, 96%, 5-(Benzyloxy)-1H-benzo(d)imidazole, 95+%, 6-(Benzyloxy)-1H-benzo(D)imidazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g.
6-phenylmethoxy-1H-benzimidazole (CAS 741261-57-4) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 6-phenylmethoxy-1H-benzimidazole. InChIKey: YLLJHBKZAXJEIJ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-benzimidazole |
| InChIKey | YLLJHBKZAXJEIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)N=CN3 |
Computed by PubChem (NCBI)