Products 74168-08-4
CAS 74168-08-4 is the registry number for Losmiprofen. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
2-[3-(4-chlorobenzoyl)-2-methylphenoxy]propanoic acid (CAS 74168-08-4) is a chemical compound with the molecular formula C17H15ClO4 and a molecular weight of 318.7 g/mol. IUPAC name: 2-[3-(4-chlorobenzoyl)-2-methylphenoxy]propanoic acid. InChIKey: JQYJAGNNCNBFRM-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO4 |
|---|---|
| Molecular weight | 318.7 g/mol |
| IUPAC name | 2-[3-(4-chlorobenzoyl)-2-methylphenoxy]propanoic acid |
| InChIKey | JQYJAGNNCNBFRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1OC(C)C(=O)O)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)