Products 742099-40-7
CAS 742099-40-7 is the registry number for 5-Bromo-2-(pyrrolidin-1-yl)benzaldehyde, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 500mg.
5-bromo-2-pyrrolidin-1-ylbenzaldehyde (CAS 742099-40-7) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 5-bromo-2-pyrrolidin-1-ylbenzaldehyde. InChIKey: JARYZLUYHJBEER-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 5-bromo-2-pyrrolidin-1-ylbenzaldehyde |
| InChIKey | JARYZLUYHJBEER-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)