CAS 74277-66-0 is the registry number for 6-Chloro-7-hydroxychroman-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-chloro-7-hydroxy-2,3-dihydrochromen-4-one (CAS 74277-66-0) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 6-chloro-7-hydroxy-2,3-dihydrochromen-4-one. InChIKey: FAVCXTXNWXODPJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 6-chloro-7-hydroxy-2,3-dihydrochromen-4-one |
| InChIKey | FAVCXTXNWXODPJ-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1=O)Cl)O |
Computed by PubChem (NCBI)