Products 74339-45-0
CAS 74339-45-0 appears in our catalog under these names: Methyl 2-(5-chloro-1H-indol-3-yl)acetate, 97%, Methyl 2–(5–chloro–1H–indol–3–yl)acetate. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 2-(5-chloro-1H-indol-3-yl)acetate (CAS 74339-45-0) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: methyl 2-(5-chloro-1H-indol-3-yl)acetate. InChIKey: QLTNJBDKTUWQFP-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | methyl 2-(5-chloro-1H-indol-3-yl)acetate |
| InChIKey | QLTNJBDKTUWQFP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CNC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)