Products 74413-59-5
CAS 74413-59-5 is the registry number for Gliquidone Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one (CAS 74413-59-5) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one. InChIKey: QEOQPJMRMBOFFQ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one |
| InChIKey | QEOQPJMRMBOFFQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)OC)C(=O)C1=NO)C |
Computed by PubChem (NCBI)