CAS 74442-17-4 appears in our catalog under these names: 4,4,6-Trimethyl-4h-pyrrolo[3,2,1-ij]quinoline-1,2-dione, 95%, 4,4,6-TRimethyl-4h-pyrrolo(3,2,1-ij)quinoline-1,2-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione (CAS 74442-17-4) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione. InChIKey: UZKCZJAPTCTWEN-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione |
| InChIKey | UZKCZJAPTCTWEN-UHFFFAOYSA-N |
| SMILES | CC1=CC(N2C3=C1C=CC=C3C(=O)C2=O)(C)C |
Computed by PubChem (NCBI)