Products 74495-72-0
CAS 74495-72-0 appears in our catalog under these names: rac 4-Hydroxy-3-methoxyphenylethylene Glycol-d3, 3-Methoxy-4-hydroxyphenylglycol-d3, 99.52%. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
1-[4-hydroxy-3-(trideuteriomethoxy)phenyl]ethane-1,2-diol (CAS 74495-72-0) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 187.21 g/mol. IUPAC name: 1-[4-hydroxy-3-(trideuteriomethoxy)phenyl]ethane-1,2-diol. InChIKey: FBWPWWWZWKPJFL-FIBGUPNXSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 1-[4-hydroxy-3-(trideuteriomethoxy)phenyl]ethane-1,2-diol |
| InChIKey | FBWPWWWZWKPJFL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C(CO)O)O |
Computed by PubChem (NCBI)