CAS 74512-60-0 is the registry number for 5,7,4'-Trimethoxy-4-phenylcoumarin. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
5,7-dimethoxy-4-(4-methoxyphenyl)chromen-2-one (CAS 74512-60-0) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 5,7-dimethoxy-4-(4-methoxyphenyl)chromen-2-one. InChIKey: LUAQJOITTQBGCV-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 5,7-dimethoxy-4-(4-methoxyphenyl)chromen-2-one |
| InChIKey | LUAQJOITTQBGCV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)OC3=C2C(=CC(=C3)OC)OC |
Computed by PubChem (NCBI)