Products 74554-11-3
CAS 74554-11-3 is the registry number for Alpha-L-2-Fluorofucopyranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4R,5S,6S)-3-fluoro-6-methyloxane-2,4,5-triol (CAS 74554-11-3) is a chemical compound with the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-3-fluoro-6-methyloxane-2,4,5-triol. InChIKey: IRKXGKIPOMIQOD-MDMQIMBFSA-N.
| Molecular formula | C6H11FO4 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-3-fluoro-6-methyloxane-2,4,5-triol |
| InChIKey | IRKXGKIPOMIQOD-MDMQIMBFSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O)F)O)O |
Computed by PubChem (NCBI)