Products 745783-72-6
CAS 745783-72-6 is the registry number for (S)-(-)-1-(4-Chlorophenyl)ethyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-4-[(1S)-1-isocyanatoethyl]benzene (CAS 745783-72-6) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 1-chloro-4-[(1S)-1-isocyanatoethyl]benzene. InChIKey: MDGZWQDRYKKTOB-ZETCQYMHSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 1-chloro-4-[(1S)-1-isocyanatoethyl]benzene |
| InChIKey | MDGZWQDRYKKTOB-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Cl)N=C=O |
Computed by PubChem (NCBI)