CAS 745783-82-8 is the registry number for (R)-1-(1-Isocyanatoethyl)-4-methoxybenzene, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-[(1R)-1-isocyanatoethyl]-4-methoxybenzene (CAS 745783-82-8) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-[(1R)-1-isocyanatoethyl]-4-methoxybenzene. InChIKey: WTNKKJUXEYSETC-MRVPVSSYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-[(1R)-1-isocyanatoethyl]-4-methoxybenzene |
| InChIKey | WTNKKJUXEYSETC-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)OC)N=C=O |
Computed by PubChem (NCBI)