CAS 7465-96-5 is the registry number for N-(4-Bromophenyl)-4-methoxybenzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-bromophenyl)-4-methoxybenzamide (CAS 7465-96-5) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: N-(4-bromophenyl)-4-methoxybenzamide. InChIKey: QDYDNKAVIIBNDO-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-methoxybenzamide |
| InChIKey | QDYDNKAVIIBNDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)