Products 7469-49-0

CAS 7469-49-0 is the registry number for Nav1.2-IN-2, 99.82%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 25 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

Butyl N-[3-(butoxycarbonylamino)-4-methylphenyl]carbamate (CAS 7469-49-0) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: butyl N-[3-(butoxycarbonylamino)-4-methylphenyl]carbamate. InChIKey: KOBZWUMLQLKNMP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26N2O4
Molecular weight322.4 g/mol
IUPAC namebutyl N-[3-(butoxycarbonylamino)-4-methylphenyl]carbamate
InChIKeyKOBZWUMLQLKNMP-UHFFFAOYSA-N
SMILESCCCCOC(=O)NC1=CC(=C(C=C1)C)NC(=O)OCCCC

Computed by PubChem (NCBI)