CAS 7471-12-7 appears in our catalog under these names: ecMetAP-IN-1, 98.12%, 6-Methyl-2-(pyridin-2-yl)-1H-benzo[d]imidazole, ≥98%, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 5mg, 25mg, 100mg.
6-methyl-2-pyridin-2-yl-1H-benzimidazole (CAS 7471-12-7) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 6-methyl-2-pyridin-2-yl-1H-benzimidazole. InChIKey: HFYFOFMVURXVSD-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 6-methyl-2-pyridin-2-yl-1H-benzimidazole |
| InChIKey | HFYFOFMVURXVSD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)