CAS 74772-78-4 appears in our catalog under these names: 5–(4–Hydroxybenzyl)–2,4–thiazolidinedione, 5-(4-Hydroxybenzyl)-2,4-thiazolidinedione, 95%, 5-(4-Hydroxybenzyl)thiazolidine-2,4-dione 95%, 5-(4-Hydroxybenzyl)thiazolidine-2,4-dione, ≥95%, 5-(4-Hydroxybenzyl)thiazolidine-2,4-dione, 95-<97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (CAS 74772-78-4) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: NKOHRVBBQISBSB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | NKOHRVBBQISBSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2C(=O)NC(=O)S2)O |
Computed by PubChem (NCBI)