Products 74881-60-0
CAS 74881-60-0 is the registry number for N-Methyl-N-(1-naphthyl)-1-chlorobenzamide. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
2-chloro-N-methyl-N-naphthalen-2-ylbenzamide (CAS 74881-60-0) is a chemical compound with the molecular formula C18H14ClNO and a molecular weight of 295.8 g/mol. IUPAC name: 2-chloro-N-methyl-N-naphthalen-2-ylbenzamide. InChIKey: WCMRXMRZQCWDPK-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-naphthalen-2-ylbenzamide |
| InChIKey | WCMRXMRZQCWDPK-UHFFFAOYSA-N |
| SMILES | CN(C1=CC2=CC=CC=C2C=C1)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)