Products 7499-56-1
CAS 7499-56-1 appears in our catalog under these names: 2-Bromocinnamic Acid, 2–Bromocinnamic Acid, 2-Bromocinnamic acid/ 98+%, 2-Propenoic acid, 3-(2-bromophenyl)-, 97%, 97%, 3-(2-Bromophenyl)acrylic acid, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 2,5g, 250mg, 1g.
(E)-3-(2-bromophenyl)prop-2-enoic acid (CAS 7499-56-1) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: (E)-3-(2-bromophenyl)prop-2-enoic acid. InChIKey: OMHDOOAFLCMRFX-AATRIKPKSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | (E)-3-(2-bromophenyl)prop-2-enoic acid |
| InChIKey | OMHDOOAFLCMRFX-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
2-Bromocinnamic acid, trans-2-Bromocinnamic acid, 3-(2-Bromophenyl)acrylic acid, o-Bromocinnamic acid, (E)-3-(2-bromophenyl)prop-2-enoic acid, (E)-3-(2-Bromophenyl)acrylic acid, (2E)-3-(2-bromophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2-bromophenyl)-, (E)-3-(2-Bromophenyl)propenoic acid, 3-(2-bromo-phenyl)-acrylic acid