CAS 75039-60-0 appears in our catalog under these names: 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 98%, 98%, 5-((Dimethylamino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-(dimethylaminomethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 75039-60-0) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: 5-(dimethylaminomethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: YKMXFLMJEHHKMU-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 5-(dimethylaminomethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | YKMXFLMJEHHKMU-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CN(C)C)C(=O)O1)C |
Computed by PubChem (NCBI)