CAS 75200-74-7 appears in our catalog under these names: 2-Ethyl-2-methyl-2H-1,3-benzodioxol-5-amine, 95%, 2-Ethyl-2-methyl-1,3-dioxaindan-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-ethyl-2-methyl-1,3-benzodioxol-5-amine (CAS 75200-74-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-ethyl-2-methyl-1,3-benzodioxol-5-amine. InChIKey: ZFOWCCGICLWLGD-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-ethyl-2-methyl-1,3-benzodioxol-5-amine |
| InChIKey | ZFOWCCGICLWLGD-UHFFFAOYSA-N |
| SMILES | CCC1(OC2=C(O1)C=C(C=C2)N)C |
Computed by PubChem (NCBI)