CAS 75235-67-5 appears in our catalog under these names: tert-Butyl 2-carbamothioyl-2,2-dimethylacetate, tert-Butyl 2-carbamothioyl-2,2-dimethylacetate 95%, tert-Butyl 2-carbamothioyl-2,2-dimethylacetate, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
Tert-butyl 3-amino-2,2-dimethyl-3-sulfanylidenepropanoate (CAS 75235-67-5) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: tert-butyl 3-amino-2,2-dimethyl-3-sulfanylidenepropanoate. InChIKey: VBZRIIYWBBDXAI-UHFFFAOYSA-N.
| Molecular formula | C9H17NO2S |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | tert-butyl 3-amino-2,2-dimethyl-3-sulfanylidenepropanoate |
| InChIKey | VBZRIIYWBBDXAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C)C(=S)N |
Computed by PubChem (NCBI)