CAS 75281-25-3 appears in our catalog under these names: Isotretinoin EP Impurity I, Isotretinoin EP Impurity I (13-cis-4-Hydroxy-Retinoic Acid, 4-Hydroxy Isotretinoin), (2Z,4E,6E,8E)-9-(3-Hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid, 98%, 4-Hydroxy-13-cis-retinoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
(2Z,4E,6E,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (CAS 75281-25-3) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (2Z,4E,6E,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid. InChIKey: KGUMXGDKXYTTEY-FAOQNJJDSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2Z,4E,6E,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| InChIKey | KGUMXGDKXYTTEY-FAOQNJJDSA-N |
| SMILES | CC1=C(C(CCC1O)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)O)/C)/C |
Computed by PubChem (NCBI)