CAS 75294-50-7 appears in our catalog under these names: tert-Butyl 4-isocyanatobenzoate, 95%, tert-Butyl 4-isocyanatobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 4-isocyanatobenzoate (CAS 75294-50-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: tert-butyl 4-isocyanatobenzoate. InChIKey: RVYPZXSBYFJLDZ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | tert-butyl 4-isocyanatobenzoate |
| InChIKey | RVYPZXSBYFJLDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)N=C=O |
Computed by PubChem (NCBI)