CAS 752971-41-8 is the registry number for H-alpha-Me-D-Phe(4-Br)-OH. Offered by: Creative Peptides. Available pack sizes: 1g.
(2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoic acid (CAS 752971-41-8) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoic acid. InChIKey: PEGRPUVDOKWERK-SNVBAGLBSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoic acid |
| InChIKey | PEGRPUVDOKWERK-SNVBAGLBSA-N |
| SMILES | C[C@@](CC1=CC=C(C=C1)Br)(C(=O)O)N |
Computed by PubChem (NCBI)