CAS 7538-38-7 appears in our catalog under these names: (4-Vinylbenzyl)trimethylammonium chloride, 95-<97%, (4-Vinylbenzyl)trimethylammonium chloride, ≥97-<99%, N,N,N-Trimethyl-1-(4-vinylphenyl)methanaminium chloride, 97% mix TBC as stabilizer, N,N,N–Trimethyl–1–(4–vinylphenyl)methanaminium chloride, N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride. Offered by: Hoffman Fine Chemicals, AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 5g, 1g.
(4-ethenylphenyl)methyl-trimethylazanium chloride (CAS 7538-38-7) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: (4-ethenylphenyl)methyl-trimethylazanium chloride. InChIKey: TVXNKQRAZONMHJ-UHFFFAOYSA-M.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | (4-ethenylphenyl)methyl-trimethylazanium chloride |
| InChIKey | TVXNKQRAZONMHJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC1=CC=C(C=C1)C=C.[Cl-] |
Computed by PubChem (NCBI)