Products 754121-64-7
CAS 754121-64-7 is the registry number for 5–(4–Chlorophenyl)pyrrolidine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
5-(4-chlorophenyl)pyrrolidine-2-carboxylic acid (CAS 754121-64-7) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: 5-(4-chlorophenyl)pyrrolidine-2-carboxylic acid. InChIKey: CIDBGTQSUQXHLM-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyrrolidine-2-carboxylic acid |
| InChIKey | CIDBGTQSUQXHLM-UHFFFAOYSA-N |
| SMILES | C1CC(NC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)