Products 7546-52-3
CAS 7546-52-3 appears in our catalog under these names: Methyl 2-(2-methyl-1h-pyrrolo[2,3-b]pyridin-3-yl)acetate, 95%, Methyl 2-(2-methyl-1h-pyrrolo(2,3-b)pyridin-3-yl)acetate, Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate, 95%, 95%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS 7546-52-3) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate. InChIKey: YNBGGUBQXVTLST-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate |
| InChIKey | YNBGGUBQXVTLST-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)N=CC=C2)CC(=O)OC |
Computed by PubChem (NCBI)