CAS 75464-10-7 is the registry number for Dithranol Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one (CAS 75464-10-7) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one. InChIKey: KRTYVWKREPCSNP-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one |
| InChIKey | KRTYVWKREPCSNP-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC=C3O |
Computed by PubChem (NCBI)