Products 75464-10-7

CAS 75464-10-7 is the registry number for Dithranol Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one (CAS 75464-10-7) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one. InChIKey: KRTYVWKREPCSNP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14O4
Molecular weight282.29 g/mol
IUPAC name1,8-dihydroxy-10-propanoyl-10H-anthracen-9-one
InChIKeyKRTYVWKREPCSNP-UHFFFAOYSA-N
SMILESCCC(=O)C1C2=C(C(=CC=C2)O)C(=O)C3=C1C=CC=C3O

Computed by PubChem (NCBI)