Products 755036-38-5
CAS 755036-38-5 is the registry number for Dichotomine A. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 755036-38-5) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: BWIXNBSQYZAAFZ-ZETCQYMHSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 1-[(1S)-1-hydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | BWIXNBSQYZAAFZ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=C2C(=CC(=N1)C(=O)O)C3=CC=CC=C3N2)O |
Computed by PubChem (NCBI)