Products 755036-41-0
CAS 755036-41-0 appears in our catalog under these names: Dichotomine B, Dichotomine B, Dichotomine B, 99.56%, Dichotomine B, ≥98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 755036-41-0) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: PKSXEHHRROSXPR-NSHDSACASA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | PKSXEHHRROSXPR-NSHDSACASA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)[C@H](CO)O)C(=O)O |
Computed by PubChem (NCBI)