Products 757220-94-3
CAS 757220-94-3 is the registry number for (3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)urea. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3,4-dihydro-2H-1,5-benzodioxepin-7-ylurea (CAS 757220-94-3) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-7-ylurea. InChIKey: WUYPBLGXXZYPME-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-7-ylurea |
| InChIKey | WUYPBLGXXZYPME-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)NC(=O)N)OC1 |
Computed by PubChem (NCBI)