Products 75833-26-0
CAS 75833-26-0 appears in our catalog under these names: 3′,4′–Dimethyl–2,2,2–trifluoroacetophenone, 3',4'-Dimethyl-2,2,2-trifluoroacetophenone, 98%, 98%, 3',4'-Dimethyl-2,2,2-trifluoroacetophenone, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
1-(3,4-dimethylphenyl)-2,2,2-trifluoroethanone (CAS 75833-26-0) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-2,2,2-trifluoroethanone. InChIKey: AJVJGZSCQYMMDI-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | AJVJGZSCQYMMDI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)