CAS 7598-70-1 appears in our catalog under these names: Diethyl 2-(4-nitrobenzyl)malonate, 96%, Diethyl 2–(4–nitrobenzyl)malonate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg.
Diethyl 2-[(4-nitrophenyl)methyl]propanedioate (CAS 7598-70-1) is a chemical compound with the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. IUPAC name: diethyl 2-[(4-nitrophenyl)methyl]propanedioate. InChIKey: DDENYKBUELXLAQ-UHFFFAOYSA-N.
| Molecular formula | C14H17NO6 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | diethyl 2-[(4-nitrophenyl)methyl]propanedioate |
| InChIKey | DDENYKBUELXLAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)