CAS 75991-00-3 appears in our catalog under these names: 5-Bromo-N-(3-methoxyphenyl)-2-furamide, 5-Bromo-n-(3-methoxyphenyl)-2-furamide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 10g, 5g.
5-bromo-N-(3-methoxyphenyl)furan-2-carboxamide (CAS 75991-00-3) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 5-bromo-N-(3-methoxyphenyl)furan-2-carboxamide. InChIKey: ZBBUKBYFONNZIN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 5-bromo-N-(3-methoxyphenyl)furan-2-carboxamide |
| InChIKey | ZBBUKBYFONNZIN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)