Products 76045-30-2
CAS 76045-30-2 appears in our catalog under these names: Desferrithiocin sodium salt, Desferriferrithiocin, Desferrithiocin sodium salt >= 98 % HPLC. Offered by: Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg, 10 mg, 5 mg, 1 mg.
Methyl (4S)-2-(3-hydroxy-2-pyridinyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 76045-30-2) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: methyl (4S)-2-(3-hydroxy-2-pyridinyl)-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: MXNMKXDOWGYTSV-ZCFIWIBFSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | methyl (4S)-2-(3-hydroxy-2-pyridinyl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | MXNMKXDOWGYTSV-ZCFIWIBFSA-N |
| SMILES | COC(=O)[C@H]1CSC(=N1)C2=C(C=CC=N2)O |
Computed by PubChem (NCBI)