CAS 761001-64-3 is the registry number for 4-Bromo-N,N-diethyl-3-fluoroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-N,N-diethyl-3-fluoroaniline (CAS 761001-64-3) is a chemical compound with the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. IUPAC name: 4-bromo-N,N-diethyl-3-fluoroaniline. InChIKey: RKIYKABTXNDNOW-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFN |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-3-fluoroaniline |
| InChIKey | RKIYKABTXNDNOW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)