CAS 76162-60-2 is the registry number for 3-Methyl Alpha-Carboline. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
3-methyl-9H-pyrido[2,3-b]indole (CAS 76162-60-2) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-methyl-9H-pyrido[2,3-b]indole. InChIKey: KZCHBHJWVHWOCE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-methyl-9H-pyrido[2,3-b]indole |
| InChIKey | KZCHBHJWVHWOCE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(NC3=CC=CC=C32)N=C1 |
Computed by PubChem (NCBI)