CAS 76240-49-8 appears in our catalog under these names: 6–Bromophthalazine–1,4–diol, 6-Bromophthalazine-1,4-diol 95%, 6-Bromophthalazine-1,4-diol, 95%, 95%, 6-Bromophthalazine-1,4-diol, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 6g.
6-bromo-2,3-dihydrophthalazine-1,4-dione (CAS 76240-49-8) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-2,3-dihydrophthalazine-1,4-dione. InChIKey: UFWQSROUAIPXQJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | UFWQSROUAIPXQJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)NNC2=O |
Computed by PubChem (NCBI)