Products 763-51-9

CAS 763-51-9 is the registry number for 1,4-Diethyl 2-bromobutanedioate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Diethyl 2-bromobutanedioate (CAS 763-51-9) is a chemical compound with the molecular formula C8H13BrO4 and a molecular weight of 253.09 g/mol. IUPAC name: diethyl 2-bromobutanedioate. InChIKey: RUIJMAUNJVDAEE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13BrO4
Molecular weight253.09 g/mol
IUPAC namediethyl 2-bromobutanedioate
InChIKeyRUIJMAUNJVDAEE-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(=O)OCC)Br

Computed by PubChem (NCBI)