Products 76475-63-3
CAS 76475-63-3 appears in our catalog under these names: N-(2,4-Dimethyl-phenyl)-succinamic acid, 95%, 4-((2,4-Dimethylphenyl)amino)-4-oxobutanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
4-(2,4-dimethylanilino)-4-oxobutanoic acid (CAS 76475-63-3) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(2,4-dimethylanilino)-4-oxobutanoic acid. InChIKey: HQTDVYMOUQKBBR-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(2,4-dimethylanilino)-4-oxobutanoic acid |
| InChIKey | HQTDVYMOUQKBBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CCC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
N-(2,4-Dimethyl-phenyl)-succinamic acid, 3-[(2,4-dimethylphenyl)carbamoyl]propanoic acid, 4-(2,4-dimethylanilino)-4-oxobutanoic acid, 4-[(2,4-dimethylphenyl)amino]-4-oxobutanoic acid, 4-((2,4-dimethylphenyl)amino)-4-oxobutanoic acid, CBMicro_005086, Cambridge id 5112411, Oprea1_873972, 4-(2,4-dimethylanilino)-4-oxo-butanoic acid, 3-[N-(2,4-dimethylphenyl)carbamoyl]propanoic acid