CAS 76478-30-3 is the registry number for 2–acetoxy–5–bromobenzoic acid methyl ester. Offered by: GLPBio. Available pack sizes: 200mg.
Methyl 2-acetyloxy-5-bromobenzoate (CAS 76478-30-3) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: methyl 2-acetyloxy-5-bromobenzoate. InChIKey: KXPPKKXYTWNOPF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | methyl 2-acetyloxy-5-bromobenzoate |
| InChIKey | KXPPKKXYTWNOPF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)