CAS 7652-29-1 appears in our catalog under these names: 6–Chloro–2,4–dihydro–1,4–benzoxazin–3–one, 6-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%, 98%, 6-Chloro-2H-1,4-benzoxazin-3(4H)-one, 95%, 6-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 10g, 100g.
6-chloro-4H-1,4-benzoxazin-3-one (CAS 7652-29-1) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 6-chloro-4H-1,4-benzoxazin-3-one. InChIKey: OBPIPKQQNRACHV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 6-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | OBPIPKQQNRACHV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)