Products 76553-18-9
CAS 76553-18-9 appears in our catalog under these names: Indobufen Impurity 7, Indobufen Impurity 3, Indobufen Impurity 22. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-(1-hydroxy-3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (CAS 76553-18-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 2-[4-(1-hydroxy-3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid. InChIKey: DGJOJYKWGDTQRR-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 2-[4-(1-hydroxy-3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| InChIKey | DGJOJYKWGDTQRR-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)N2C(C3=CC=CC=C3C2=O)O)C(=O)O |
Computed by PubChem (NCBI)