Products 76635-88-6

CAS 76635-88-6 is the registry number for Vinyl-2-naphthylcarbinol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-naphthalen-2-ylprop-2-en-1-ol (CAS 76635-88-6) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 1-naphthalen-2-ylprop-2-en-1-ol. InChIKey: LORCFVPTNMHNOU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O
Molecular weight184.23 g/mol
IUPAC name1-naphthalen-2-ylprop-2-en-1-ol
InChIKeyLORCFVPTNMHNOU-UHFFFAOYSA-N
SMILESC=CC(C1=CC2=CC=CC=C2C=C1)O

Computed by PubChem (NCBI)